About 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine
2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine (PubChem CID 18526272) has the molecular formula C12H16FNOS
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine |
| PubChem CID | 18526272 |
| Molecular Formula | C12H16FNOS |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine |
| SMILES | FCCCOc1ccc(C2NCCS2)cc1 |
| InChI | InChI=1S/C12H16FNOS/c13-6-1-8-15-11-4-2-10(3-5-11)12-14-7-9-16-12/h2-5,12,14H,1,6-9H2 |
| InChIKey | YJMNOVGUJOGKGS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine?
The IUPAC name of 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine (CID 18526272) is 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine.
What is the SMILES notation for 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine?
The canonical SMILES for 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine is FCCCOc1ccc(C2NCCS2)cc1.
What is the InChIKey of 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine?
The InChIKey is YJMNOVGUJOGKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNOS/c13-6-1-8-15-11-4-2-10(3-5-11)12-14-7-9-16-12/h2-5,12,14H,1,6-9H2.
What are the key properties of 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine?
2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine has a molecular weight of 241.33 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine is sourced from PubChem (CID 18526272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).