About 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride
4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride (PubChem CID 18526314) has the molecular formula C17H15Br2ClN2
and a molecular weight of 442.58 g/mol. Its IUPAC name is 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride |
| PubChem CID | 18526314 |
| Molecular Formula | C17H15Br2ClN2 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride |
| SMILES | Brc1ccc(/N=C/C=C/C=C/Nc2ccc(Br)cc2)cc1.Cl |
| InChI | InChI=1S/C17H14Br2N2.ClH/c18-14-4-8-16(9-5-14)20-12-2-1-3-13-21-17-10-6-15(19)7-11-17;/h1-13,20H;1H/b3-1+,12-2+,21-13+; |
| InChIKey | MCDSOHZOMAADNA-UXHCFQRASA-N |
| XLogP | 6.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride?
The IUPAC name of 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride (CID 18526314) is 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride.
What is the SMILES notation for 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride?
The canonical SMILES for 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride is Brc1ccc(/N=C/C=C/C=C/Nc2ccc(Br)cc2)cc1.Cl.
What is the InChIKey of 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride?
The InChIKey is MCDSOHZOMAADNA-UXHCFQRASA-N. The full InChI is InChI=1S/C17H14Br2N2.ClH/c18-14-4-8-16(9-5-14)20-12-2-1-3-13-21-17-10-6-15(19)7-11-17;/h1-13,20H;1H/b3-1+,12-2+,21-13+;.
What are the key properties of 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride?
4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride has a molecular weight of 442.58 g/mol, XLogP of 6.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-[(1E,3E)-5-(4-bromophenyl)iminopenta-1,3-dienyl]aniline;hydrochloride is sourced from PubChem (CID 18526314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).