About 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride
2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride (PubChem CID 18526449) has the molecular formula C7H10ClN3OS
and a molecular weight of 219.70 g/mol. Its IUPAC name is 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride |
| PubChem CID | 18526449 |
| Molecular Formula | C7H10ClN3OS |
| Molecular Weight | 219.70 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride |
| SMILES | Cl.NCc1ccc2nsnc2c1.O |
| InChI | InChI=1S/C7H7N3S.ClH.H2O/c8-4-5-1-2-6-7(3-5)10-11-9-6;;/h1-3H,4,8H2;1H;1H2 |
| InChIKey | XSWHKFLUNQBPDO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.70 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride?
The IUPAC name of 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride (CID 18526449) is 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride.
What is the SMILES notation for 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride?
The canonical SMILES for 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride is Cl.NCc1ccc2nsnc2c1.O.
What is the InChIKey of 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride?
The InChIKey is XSWHKFLUNQBPDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S.ClH.H2O/c8-4-5-1-2-6-7(3-5)10-11-9-6;;/h1-3H,4,8H2;1H;1H2.
What are the key properties of 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride?
2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride has a molecular weight of 219.70 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1,3-benzothiadiazol-5-ylmethanamine;hydrate;hydrochloride is sourced from PubChem (CID 18526449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).