About diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride
diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride (PubChem CID 18527349) has the molecular formula C24H28ClNO5
and a molecular weight of 445.94 g/mol. Its IUPAC name is diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride.
Molecular Properties
| Compound Name | diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride |
| PubChem CID | 18527349 |
| Molecular Formula | C24H28ClNO5 |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride |
| SMILES | CCOC(=O)C1C(=O)C(C(=O)OCC)C(c2ccccc2)N(C)C1c1ccccc1.Cl |
| InChI | InChI=1S/C24H27NO5.ClH/c1-4-29-23(27)18-20(16-12-8-6-9-13-16)25(3)21(17-14-10-7-11-15-17)19(22(18)26)24(28)30-5-2;/h6-15,18-21H,4-5H2,1-3H3;1H |
| InChIKey | QHXFSXCZYXQOSM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride?
The IUPAC name of diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride (CID 18527349) is diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride.
What is the SMILES notation for diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride?
The canonical SMILES for diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride is CCOC(=O)C1C(=O)C(C(=O)OCC)C(c2ccccc2)N(C)C1c1ccccc1.Cl.
What is the InChIKey of diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride?
The InChIKey is QHXFSXCZYXQOSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO5.ClH/c1-4-29-23(27)18-20(16-12-8-6-9-13-16)25(3)21(17-14-10-7-11-15-17)19(22(18)26)24(28)30-5-2;/h6-15,18-21H,4-5H2,1-3H3;1H.
What are the key properties of diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride?
diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride has a molecular weight of 445.94 g/mol, XLogP of 3.76, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1-methyl-4-oxo-2,6-diphenylpiperidine-3,5-dicarboxylate;hydrochloride is sourced from PubChem (CID 18527349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).