C17H20IN — CID 18527661
2,2,3,4-tetramethyl-1H-benzo[f]isoquinolin-3-ium iodide (PubChem CID 18527661) has the molecular formula C17H20IN and a molecular weight of 365.26 g/mol. Its IUPAC name is 2,2,3,4-tetramethyl-1H-benzo[f]isoquinolin-3-ium iodide.
| Compound Name | 2,2,3,4-tetramethyl-1H-benzo[f]isoquinolin-3-ium iodide |
|---|---|
| PubChem CID | 18527661 |
| Molecular Formula | C17H20IN |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2,2,3,4-tetramethyl-1H-benzo[f]isoquinolin-3-ium iodide |
| SMILES | CC1=[N+](C)C(C)(C)Cc2c1ccc1ccccc21.[I-] |
| InChI | InChI=1S/C17H20N.HI/c1-12-14-10-9-13-7-5-6-8-15(13)16(14)11-17(2,3)18(12)4;/h5-10H,11H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZVBMMDJMVYGHOB-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|