About 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide
2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide (PubChem CID 18527687) has the molecular formula C17H24IN3O4
and a molecular weight of 461.30 g/mol. Its IUPAC name is 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide.
Molecular Properties
| Compound Name | 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide |
| PubChem CID | 18527687 |
| Molecular Formula | C17H24IN3O4 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide |
| SMILES | CC[N+](C)(CC)CCOC(=O)Cn1c(=O)[nH]c2ccccc2c1=O.[I-] |
| InChI | InChI=1S/C17H23N3O4.HI/c1-4-20(3,5-2)10-11-24-15(21)12-19-16(22)13-8-6-7-9-14(13)18-17(19)23;/h6-9H,4-5,10-12H2,1-3H3;1H |
| InChIKey | BZXLFLAHYPHORS-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide?
The IUPAC name of 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide (CID 18527687) is 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide.
What is the SMILES notation for 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide?
The canonical SMILES for 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide is CC[N+](C)(CC)CCOC(=O)Cn1c(=O)[nH]c2ccccc2c1=O.[I-].
What is the InChIKey of 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide?
The InChIKey is BZXLFLAHYPHORS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O4.HI/c1-4-20(3,5-2)10-11-24-15(21)12-19-16(22)13-8-6-7-9-14(13)18-17(19)23;/h6-9H,4-5,10-12H2,1-3H3;1H.
What are the key properties of 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide?
2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide has a molecular weight of 461.30 g/mol, XLogP of -2.28, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]oxyethyl-diethyl-methylazanium iodide is sourced from PubChem (CID 18527687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).