About 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride
2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride (PubChem CID 18527695) has the molecular formula C14H20ClN3O2
and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride.
Molecular Properties
| Compound Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride |
| PubChem CID | 18527695 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride |
| SMILES | CCn1c(=O)c2ccccc2n(CC[NH+](C)C)c1=O.[Cl-] |
| InChI | InChI=1S/C14H19N3O2.ClH/c1-4-16-13(18)11-7-5-6-8-12(11)17(14(16)19)10-9-15(2)3;/h5-8H,4,9-10H2,1-3H3;1H |
| InChIKey | IQGHWAWHCJGYNB-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 48.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride?
The IUPAC name of 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride (CID 18527695) is 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride.
What is the SMILES notation for 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride?
The canonical SMILES for 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride is CCn1c(=O)c2ccccc2n(CC[NH+](C)C)c1=O.[Cl-].
What is the InChIKey of 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride?
The InChIKey is IQGHWAWHCJGYNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2.ClH/c1-4-16-13(18)11-7-5-6-8-12(11)17(14(16)19)10-9-15(2)3;/h5-8H,4,9-10H2,1-3H3;1H.
What are the key properties of 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride?
2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride has a molecular weight of 297.79 g/mol, XLogP of -3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-2,4-dioxoquinazolin-1-yl)ethyl-dimethylazanium chloride is sourced from PubChem (CID 18527695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).