C11H8N4O4 — CID 18527941
13-oxa-10,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,14-heptaen-8-one;dihydrate (PubChem CID 18527941) has the molecular formula C11H8N4O4 and a molecular weight of 260.21 g/mol. Its IUPAC name is 13-oxa-10,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,14-heptaen-8-one;dihydrate.
| Compound Name | 13-oxa-10,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,14-heptaen-8-one;dihydrate |
|---|---|
| PubChem CID | 18527941 |
| Molecular Formula | C11H8N4O4 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 13-oxa-10,12,14,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,14-heptaen-8-one;dihydrate |
| SMILES | O.O.O=C1c2ccccc2-c2nc3nonc3nc21 |
| InChI | InChI=1S/C11H4N4O2.2H2O/c16-9-6-4-2-1-3-5(6)7-8(9)13-11-10(12-7)14-17-15-11;;/h1-4H;2*1H2 |
| InChIKey | LKKOUQQVXTWTSA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 144.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |