C16H34I2N2O4 — CID 18528267
ethyl-[2-[4-[2-[ethyl(dimethyl)azaniumyl]ethoxy]-4-oxobutanoyl]oxyethyl]-dimethylazanium diiodide (PubChem CID 18528267) has the molecular formula C16H34I2N2O4 and a molecular weight of 572.27 g/mol. Its IUPAC name is ethyl-[2-[4-[2-[ethyl(dimethyl)azaniumyl]ethoxy]-4-oxobutanoyl]oxyethyl]-dimethylazanium diiodide.
| Compound Name | ethyl-[2-[4-[2-[ethyl(dimethyl)azaniumyl]ethoxy]-4-oxobutanoyl]oxyethyl]-dimethylazanium diiodide |
|---|---|
| PubChem CID | 18528267 |
| Molecular Formula | C16H34I2N2O4 |
| Molecular Weight | 572.27 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | ethyl-[2-[4-[2-[ethyl(dimethyl)azaniumyl]ethoxy]-4-oxobutanoyl]oxyethyl]-dimethylazanium diiodide |
| SMILES | CC[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)CC.[I-].[I-] |
| InChI | InChI=1S/C16H34N2O4.2HI/c1-7-17(3,4)11-13-21-15(19)9-10-16(20)22-14-12-18(5,6)8-2;;/h7-14H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | JRSCAPFDWVMKBN-UHFFFAOYSA-L |
| XLogP | -4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.27 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|