About diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide
diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide (PubChem CID 18528291) has the molecular formula C20H31IN2O2
and a molecular weight of 458.38 g/mol. Its IUPAC name is diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide.
Molecular Properties
| Compound Name | diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide |
| PubChem CID | 18528291 |
| Molecular Formula | C20H31IN2O2 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide |
| SMILES | CCC1(c2ccccc2)CCC(=O)N(CC[N+](C)(CC)CC)C1=O.[I-] |
| InChI | InChI=1S/C20H31N2O2.HI/c1-5-20(17-11-9-8-10-12-17)14-13-18(23)21(19(20)24)15-16-22(4,6-2)7-3;/h8-12H,5-7,13-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HLBPXZQEWSUXEO-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide?
The IUPAC name of diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide (CID 18528291) is diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide.
What is the SMILES notation for diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide?
The canonical SMILES for diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide is CCC1(c2ccccc2)CCC(=O)N(CC[N+](C)(CC)CC)C1=O.[I-].
What is the InChIKey of diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide?
The InChIKey is HLBPXZQEWSUXEO-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H31N2O2.HI/c1-5-20(17-11-9-8-10-12-17)14-13-18(23)21(19(20)24)15-16-22(4,6-2)7-3;/h8-12H,5-7,13-16H2,1-4H3;1H/q+1;/p-1.
What are the key properties of diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide?
diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide has a molecular weight of 458.38 g/mol, XLogP of -0.03, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-[2-(3-ethyl-2,6-dioxo-3-phenylpiperidin-1-yl)ethyl]-methylazanium iodide is sourced from PubChem (CID 18528291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).