About methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate
methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate (PubChem CID 18528910) has the molecular formula C14H28N4S
and a molecular weight of 284.47 g/mol. Its IUPAC name is methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate.
Molecular Properties
| Compound Name | methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate |
| PubChem CID | 18528910 |
| Molecular Formula | C14H28N4S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate |
| SMILES | CS/C(=N/N=C(\C)C(C)(C)C)N/N=C(\C)C(C)(C)C |
| InChI | InChI=1S/C14H28N4S/c1-10(13(3,4)5)15-17-12(19-9)18-16-11(2)14(6,7)8/h1-9H3,(H,17,18)/b15-10+,16-11+ |
| InChIKey | GZWLUCBFZNJQLQ-RWPWKDLBSA-N |
| XLogP | 4.14 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate?
The IUPAC name of methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate (CID 18528910) is methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate.
What is the SMILES notation for methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate?
The canonical SMILES for methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate is CS/C(=N/N=C(\C)C(C)(C)C)N/N=C(\C)C(C)(C)C.
What is the InChIKey of methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate?
The InChIKey is GZWLUCBFZNJQLQ-RWPWKDLBSA-N. The full InChI is InChI=1S/C14H28N4S/c1-10(13(3,4)5)15-17-12(19-9)18-16-11(2)14(6,7)8/h1-9H3,(H,17,18)/b15-10+,16-11+.
What are the key properties of methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate?
methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate has a molecular weight of 284.47 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N,N'-bis[(E)-3,3-dimethylbutan-2-ylideneamino]carbamimidothioate is sourced from PubChem (CID 18528910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).