C26H22N5 — CID 18529456
4-(2,3,4-triphenyl-1H,3H-1,2,4,5-tetraazin-6-yl)phenylamine (PubChem CID 18529456) has the molecular formula C26H22N5 and a molecular weight of 404.50 g/mol.
| Compound Name | 4-(2,3,4-triphenyl-1H,3H-1,2,4,5-tetraazin-6-yl)phenylamine |
|---|---|
| PubChem CID | 18529456 |
| Molecular Formula | C26H22N5 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | — |
| SMILES | Nc1ccc(C2=NN(c3ccccc3)C(c3ccccc3)N(c3ccccc3)[N]2)cc1 |
| InChI | InChI=1S/C26H22N5/c27-22-18-16-20(17-19-22)25-28-30(23-12-6-2-7-13-23)26(21-10-4-1-5-11-21)31(29-25)24-14-8-3-9-15-24/h1-19,26H,27H2 |
| InChIKey | WARAGHYKKNQOBU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|