C16H14I4N4S — CID 18529680
5-amino-3-(iodomethyl)-7-phenyl-2,3,4,7-tetrahydro-[1,3]thiazolo[3,2-a]pyridin-4-ium-6,8-dicarbonitrile;molecular iodine;iodide (PubChem CID 18529680) has the molecular formula C16H14I4N4S and a molecular weight of 802.00 g/mol. Its IUPAC name is 5-amino-3-(iodomethyl)-7-phenyl-2,3,4,7-tetrahydro-[1,3]thiazolo[3,2-a]pyridin-4-ium-6,8-dicarbonitrile;molecular iodine;iodide.
| Compound Name | 5-amino-3-(iodomethyl)-7-phenyl-2,3,4,7-tetrahydro-[1,3]thiazolo[3,2-a]pyridin-4-ium-6,8-dicarbonitrile;molecular iodine;iodide |
|---|---|
| PubChem CID | 18529680 |
| Molecular Formula | C16H14I4N4S |
| Molecular Weight | 802.00 g/mol |
| Exact Mass | 801.71 |
| IUPAC Name | 5-amino-3-(iodomethyl)-7-phenyl-2,3,4,7-tetrahydro-[1,3]thiazolo[3,2-a]pyridin-4-ium-6,8-dicarbonitrile;molecular iodine;iodide |
| SMILES | II.N#CC1=C(N)[NH+]2C(=C(C#N)C1c1ccccc1)SCC2CI.[I-] |
| InChI | InChI=1S/C16H13IN4S.I2.HI/c17-6-11-9-22-16-13(8-19)14(10-4-2-1-3-5-10)12(7-18)15(20)21(11)16;1-2;/h1-5,11,14H,6,9,20H2;;1H |
| InChIKey | WUDFOWBZHHTUDC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.00 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|