About 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate
2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate (PubChem CID 18529801) has the molecular formula C6H8N2O5
and a molecular weight of 188.14 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate.
Molecular Properties
| Compound Name | 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate |
| PubChem CID | 18529801 |
| Molecular Formula | C6H8N2O5 |
| Molecular Weight | 188.14 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate |
| SMILES | O.O=C(O)Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H6N2O4.H2O/c9-4-1-3(2-5(10)11)7-6(12)8-4;/h1H,2H2,(H,10,11)(H2,7,8,9,12);1H2 |
| InChIKey | LXQXQKFFBNOJSB-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.14 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate?
The IUPAC name of 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate (CID 18529801) is 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate.
What is the SMILES notation for 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate?
The canonical SMILES for 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate is O.O=C(O)Cc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate?
The InChIKey is LXQXQKFFBNOJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O4.H2O/c9-4-1-3(2-5(10)11)7-6(12)8-4;/h1H,2H2,(H,10,11)(H2,7,8,9,12);1H2.
What are the key properties of 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate?
2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate has a molecular weight of 188.14 g/mol, XLogP of -2.13, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-1H-pyrimidin-6-yl)acetic acid;hydrate is sourced from PubChem (CID 18529801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).