C20H20Cl2N6O2 — CID 18530084
N-[(E)-(5-chloro-2-ethoxyphenyl)methylideneamino]-4-[(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]-1,2,4-triazol-3-amine (PubChem CID 18530084) has the molecular formula C20H20Cl2N6O2 and a molecular weight of 447.33 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2-ethoxyphenyl)methylideneamino]-4-[(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]-1,2,4-triazol-3-amine.
| Compound Name | N-[(E)-(5-chloro-2-ethoxyphenyl)methylideneamino]-4-[(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 18530084 |
| Molecular Formula | C20H20Cl2N6O2 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-[(E)-(5-chloro-2-ethoxyphenyl)methylideneamino]-4-[(Z)-(5-chloro-2-ethoxyphenyl)methylideneamino]-1,2,4-triazol-3-amine |
| SMILES | CCOc1ccc(Cl)cc1/C=N\n1cnnc1N/N=C/c1cc(Cl)ccc1OCC |
| InChI | InChI=1S/C20H20Cl2N6O2/c1-3-29-18-7-5-16(21)9-14(18)11-23-26-20-27-24-13-28(20)25-12-15-10-17(22)6-8-19(15)30-4-2/h5-13H,3-4H2,1-2H3,(H,26,27)/b23-11+,25-12- |
| InChIKey | RATYBPBHQASPQA-CVYQTCDWSA-N |
| XLogP | 4.71 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|