About [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate
[4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate (PubChem CID 18530335) has the molecular formula C14H24BF4N3O
and a molecular weight of 337.17 g/mol. Its IUPAC name is [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate.
Molecular Properties
| Compound Name | [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate |
| PubChem CID | 18530335 |
| Molecular Formula | C14H24BF4N3O |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate |
| SMILES | CN(C)C(ON1CC2C3C=CC(C3)C2C1)=[N+](C)C.F[B-](F)(F)F |
| InChI | InChI=1S/C14H24N3O.BF4/c1-15(2)14(16(3)4)18-17-8-12-10-5-6-11(7-10)13(12)9-17;2-1(3,4)5/h5-6,10-13H,7-9H2,1-4H3;/q+1;-1 |
| InChIKey | ZMJBNFPRAHRHCG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 18.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate?
The IUPAC name of [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate (CID 18530335) is [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate.
What is the SMILES notation for [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate?
The canonical SMILES for [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate is CN(C)C(ON1CC2C3C=CC(C3)C2C1)=[N+](C)C.F[B-](F)(F)F.
What is the InChIKey of [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate?
The InChIKey is ZMJBNFPRAHRHCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N3O.BF4/c1-15(2)14(16(3)4)18-17-8-12-10-5-6-11(7-10)13(12)9-17;2-1(3,4)5/h5-6,10-13H,7-9H2,1-4H3;/q+1;-1.
What are the key properties of [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate?
[4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate has a molecular weight of 337.17 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-azatricyclo[5.2.1.02,6]dec-8-en-4-yloxy(dimethylamino)methylidene]-dimethylazanium tetrafluoroborate is sourced from PubChem (CID 18530335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).