C10H15N2NaO8P — CID 18531019
CID 18531019 (PubChem CID 18531019) has the molecular formula C10H15N2NaO8P and a molecular weight of 345.20 g/mol.
| Compound Name | CID 18531019 |
|---|---|
| PubChem CID | 18531019 |
| Molecular Formula | C10H15N2NaO8P |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | — |
| SMILES | Cc1cn(C2CC(O)C(COP(=O)(O)O)O2)c(=O)[nH]c1=O.[Na] |
| InChI | InChI=1S/C10H15N2O8P.Na/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18;/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18); |
| InChIKey | YDRKIYXHTAGJRY-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|