C14H15N3O4S — CID 18531216
ethyl (2Z)-3-amino-2-[5-(4-methoxyphenyl)-3H-1,3,4-oxadiazol-2-ylidene]-3-sulfanylidenepropanoate (PubChem CID 18531216) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is ethyl (2Z)-3-amino-2-[5-(4-methoxyphenyl)-3H-1,3,4-oxadiazol-2-ylidene]-3-sulfanylidenepropanoate.
| Compound Name | ethyl (2Z)-3-amino-2-[5-(4-methoxyphenyl)-3H-1,3,4-oxadiazol-2-ylidene]-3-sulfanylidenepropanoate |
|---|---|
| PubChem CID | 18531216 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | ethyl (2Z)-3-amino-2-[5-(4-methoxyphenyl)-3H-1,3,4-oxadiazol-2-ylidene]-3-sulfanylidenepropanoate |
| SMILES | CCOC(=O)/C(C(N)=S)=C1\NN=C(c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C14H15N3O4S/c1-3-20-14(18)10(11(15)22)13-17-16-12(21-13)8-4-6-9(19-2)7-5-8/h4-7,17H,3H2,1-2H3,(H2,15,22)/b13-10+ |
| InChIKey | IRUJPUUGIJJQHL-JLHYYAGUSA-N |
| XLogP | 1.04 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|