C14H14N2O2 — CID 18531924
(Z)-3-[(3-methyl-1,2-oxazol-5-yl)amino]-1-(4-methylphenyl)prop-2-en-1-one (PubChem CID 18531924) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is (Z)-3-[(3-methyl-1,2-oxazol-5-yl)amino]-1-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-[(3-methyl-1,2-oxazol-5-yl)amino]-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18531924 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (Z)-3-[(3-methyl-1,2-oxazol-5-yl)amino]-1-(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C\Nc2cc(C)no2)cc1 |
| InChI | InChI=1S/C14H14N2O2/c1-10-3-5-12(6-4-10)13(17)7-8-15-14-9-11(2)16-18-14/h3-9,15H,1-2H3/b8-7- |
| InChIKey | WODWLZHDGOJNNC-FPLPWBNLSA-N |
| XLogP | 3.10 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|