C19H17N7O3 — CID 18532036
5-[(E)-2-[3,5-dimethyl-1-(4-methylphenyl)pyrazol-4-yl]ethenyl]-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 18532036) has the molecular formula C19H17N7O3 and a molecular weight of 391.39 g/mol. Its IUPAC name is 5-[(E)-2-[3,5-dimethyl-1-(4-methylphenyl)pyrazol-4-yl]ethenyl]-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[(E)-2-[3,5-dimethyl-1-(4-methylphenyl)pyrazol-4-yl]ethenyl]-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 18532036 |
| Molecular Formula | C19H17N7O3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 5-[(E)-2-[3,5-dimethyl-1-(4-methylphenyl)pyrazol-4-yl]ethenyl]-6-nitro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1ccc(-n2nc(C)c(/C=C/c3nc4nc[nH]n4c(=O)c3[N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C19H17N7O3/c1-11-4-6-14(7-5-11)24-13(3)15(12(2)23-24)8-9-16-17(26(28)29)18(27)25-19(22-16)20-10-21-25/h4-10H,1-3H3,(H,20,21,22)/b9-8+ |
| InChIKey | OGNAIXXTIDVZNF-CMDGGOBGSA-N |
| XLogP | 2.61 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|