C28H30N6O5 — CID 18532337
(3E,5Z)-N-[5-cyano-11-methyl-2-oxo-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-3-methyl-4-nitroocta-3,5,7-trienamide (PubChem CID 18532337) has the molecular formula C28H30N6O5 and a molecular weight of 530.59 g/mol. Its IUPAC name is (3E,5Z)-N-[5-cyano-11-methyl-2-oxo-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-3-methyl-4-nitroocta-3,5,7-trienamide.
| Compound Name | (3E,5Z)-N-[5-cyano-11-methyl-2-oxo-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-3-methyl-4-nitroocta-3,5,7-trienamide |
|---|---|
| PubChem CID | 18532337 |
| Molecular Formula | C28H30N6O5 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | (3E,5Z)-N-[5-cyano-11-methyl-2-oxo-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene]-3-methyl-4-nitroocta-3,5,7-trienamide |
| SMILES | C=C/C=C\C(=C(\C)CC(=O)/N=c1\c(C#N)cc2c(=O)n3cccc(C)c3nc2n1CCCOC(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C28H30N6O5/c1-6-7-11-23(34(37)38)20(5)15-24(35)30-26-21(17-29)16-22-27(32(26)13-9-14-39-18(2)3)31-25-19(4)10-8-12-33(25)28(22)36/h6-8,10-12,16,18H,1,9,13-15H2,2-5H3/b11-7-,23-20+,30-26+ |
| InChIKey | ZCCSYHVASVKTKD-NIAOZKMRSA-N |
| XLogP | 3.75 |
| TPSA | 144.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|