About [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate
[(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate (PubChem CID 18532432) has the molecular formula C23H18F2N2O2
and a molecular weight of 392.41 g/mol. Its IUPAC name is [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate.
Molecular Properties
| Compound Name | [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate |
| PubChem CID | 18532432 |
| Molecular Formula | C23H18F2N2O2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate |
| SMILES | O=C(O/C(=C\c1nc2ccccc2n1C(F)F)C1=CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C23H18F2N2O2/c24-23(25)27-19-14-8-7-13-18(19)26-21(27)15-20(16-9-3-1-4-10-16)29-22(28)17-11-5-2-6-12-17/h1-3,5-9,11-15,23H,4,10H2/b20-15- |
| InChIKey | BLTDIKFTFJXUHO-HKWRFOASSA-N |
| XLogP | 5.91 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate?
The IUPAC name of [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate (CID 18532432) is [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate.
What is the SMILES notation for [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate?
The canonical SMILES for [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate is O=C(O/C(=C\c1nc2ccccc2n1C(F)F)C1=CC=CCC1)c1ccccc1.
What is the InChIKey of [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate?
The InChIKey is BLTDIKFTFJXUHO-HKWRFOASSA-N. The full InChI is InChI=1S/C23H18F2N2O2/c24-23(25)27-19-14-8-7-13-18(19)26-21(27)15-20(16-9-3-1-4-10-16)29-22(28)17-11-5-2-6-12-17/h1-3,5-9,11-15,23H,4,10H2/b20-15-.
What are the key properties of [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate?
[(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate has a molecular weight of 392.41 g/mol, XLogP of 5.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-cyclohexa-1,3-dien-1-yl-2-[1-(difluoromethyl)benzimidazol-2-yl]ethenyl] benzoate is sourced from PubChem (CID 18532432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).