C17H23N3O3 — CID 18532742
4-(1,3-benzoxazol-2-yl)-N-(3-methoxypropyl)piperidine-1-carboxamide (PubChem CID 18532742) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-N-(3-methoxypropyl)piperidine-1-carboxamide.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-N-(3-methoxypropyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 18532742 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-N-(3-methoxypropyl)piperidine-1-carboxamide |
| SMILES | COCCCNC(=O)N1CCC(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C17H23N3O3/c1-22-12-4-9-18-17(21)20-10-7-13(8-11-20)16-19-14-5-2-3-6-15(14)23-16/h2-3,5-6,13H,4,7-12H2,1H3,(H,18,21) |
| InChIKey | ZGTLWFZNOMMMNS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|