About 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid
4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid (PubChem CID 18533154) has the molecular formula C20H19NO5S
and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid.
Molecular Properties
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid |
| PubChem CID | 18533154 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid |
| SMILES | COc1ccc(SCC(CCN2C(=O)c3ccccc3C2=O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H19NO5S/c1-26-14-6-8-15(9-7-14)27-12-13(20(24)25)10-11-21-18(22)16-4-2-3-5-17(16)19(21)23/h2-9,13H,10-12H2,1H3,(H,24,25) |
| InChIKey | JLMICRZDTPIVIW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid?
The IUPAC name of 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid (CID 18533154) is 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid.
What is the SMILES notation for 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid?
The canonical SMILES for 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid is COc1ccc(SCC(CCN2C(=O)c3ccccc3C2=O)C(=O)O)cc1.
What is the InChIKey of 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid?
The InChIKey is JLMICRZDTPIVIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO5S/c1-26-14-6-8-15(9-7-14)27-12-13(20(24)25)10-11-21-18(22)16-4-2-3-5-17(16)19(21)23/h2-9,13H,10-12H2,1H3,(H,24,25).
What are the key properties of 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid?
4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid has a molecular weight of 385.44 g/mol, XLogP of 3.17, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxoisoindol-2-yl)-2-[(4-methoxyphenyl)sulfanylmethyl]butanoic acid is sourced from PubChem (CID 18533154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).