About (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol
(E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol (PubChem CID 18533428) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol |
| PubChem CID | 18533428 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol |
| SMILES | CC1(C)OCC(CC/C=C/CO)O1 |
| InChI | InChI=1S/C10H18O3/c1-10(2)12-8-9(13-10)6-4-3-5-7-11/h3,5,9,11H,4,6-8H2,1-2H3/b5-3+ |
| InChIKey | QVUOFMQMMITWOW-HWKANZROSA-N |
| XLogP | 1.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol?
The IUPAC name of (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol (CID 18533428) is (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol.
What is the SMILES notation for (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol?
The canonical SMILES for (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol is CC1(C)OCC(CC/C=C/CO)O1.
What is the InChIKey of (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol?
The InChIKey is QVUOFMQMMITWOW-HWKANZROSA-N. The full InChI is InChI=1S/C10H18O3/c1-10(2)12-8-9(13-10)6-4-3-5-7-11/h3,5,9,11H,4,6-8H2,1-2H3/b5-3+.
What are the key properties of (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol?
(E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol has a molecular weight of 186.25 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)pent-2-en-1-ol is sourced from PubChem (CID 18533428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).