C34H34O7 — CID 18533875
3,4,5,6-tetrakis(phenylmethoxy)oxane-2-carboxylic acid (PubChem CID 18533875) has the molecular formula C34H34O7 and a molecular weight of 554.64 g/mol. Its IUPAC name is 3,4,5,6-tetrakis(phenylmethoxy)oxane-2-carboxylic acid.
| Compound Name | 3,4,5,6-tetrakis(phenylmethoxy)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 18533875 |
| Molecular Formula | C34H34O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 3,4,5,6-tetrakis(phenylmethoxy)oxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C34H34O7/c35-33(36)31-29(37-21-25-13-5-1-6-14-25)30(38-22-26-15-7-2-8-16-26)32(39-23-27-17-9-3-10-18-27)34(41-31)40-24-28-19-11-4-12-20-28/h1-20,29-32,34H,21-24H2,(H,35,36) |
| InChIKey | DZTFRMXHQHBJOQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |