C8H14O4S — CID 18533950
2,2-dimethyl-5-(sulfanylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 18533950) has the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. Its IUPAC name is 2,2-dimethyl-5-(sulfanylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | 2,2-dimethyl-5-(sulfanylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 18533950 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2,2-dimethyl-5-(sulfanylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)OC2OC(CS)C(O)C2O1 |
| InChI | InChI=1S/C8H14O4S/c1-8(2)11-6-5(9)4(3-13)10-7(6)12-8/h4-7,9,13H,3H2,1-2H3 |
| InChIKey | BZCVUCMLLLLDKJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|