C9H18O6 — CID 18533991
2,5-dihydroxy-3,4,6-trimethoxyhexanal (PubChem CID 18533991) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,5-dihydroxy-3,4,6-trimethoxyhexanal.
| Compound Name | 2,5-dihydroxy-3,4,6-trimethoxyhexanal |
|---|---|
| PubChem CID | 18533991 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2,5-dihydroxy-3,4,6-trimethoxyhexanal |
| SMILES | COCC(O)C(OC)C(OC)C(O)C=O |
| InChI | InChI=1S/C9H18O6/c1-13-5-7(12)9(15-3)8(14-2)6(11)4-10/h4,6-9,11-12H,5H2,1-3H3 |
| InChIKey | OHWRFXMAKSGOGG-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|