About 2-(2,5-dioxopyrrol-1-yl)acetamide
2-(2,5-dioxopyrrol-1-yl)acetamide (PubChem CID 18534489) has the molecular formula C6H6N2O3
and a molecular weight of 154.12 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)acetamide |
| PubChem CID | 18534489 |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)acetamide |
| SMILES | NC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H6N2O3/c7-4(9)3-8-5(10)1-2-6(8)11/h1-2H,3H2,(H2,7,9) |
| InChIKey | OCFCFNRUPPYUGB-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)acetamide?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)acetamide (CID 18534489) is 2-(2,5-dioxopyrrol-1-yl)acetamide.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)acetamide?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)acetamide is NC(=O)CN1C(=O)C=CC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)acetamide?
The InChIKey is OCFCFNRUPPYUGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3/c7-4(9)3-8-5(10)1-2-6(8)11/h1-2H,3H2,(H2,7,9).
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)acetamide?
2-(2,5-dioxopyrrol-1-yl)acetamide has a molecular weight of 154.12 g/mol, XLogP of -1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)acetamide is sourced from PubChem (CID 18534489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).