About [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide
[3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide (PubChem CID 18535996) has the molecular formula C14H13BrFN3O2
and a molecular weight of 354.18 g/mol. Its IUPAC name is [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide.
Molecular Properties
| Compound Name | [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide |
| PubChem CID | 18535996 |
| Molecular Formula | C14H13BrFN3O2 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide |
| SMILES | Br.CC(=O)OCc1cncn1Cc1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C14H12FN3O2.BrH/c1-10(19)20-8-13-6-17-9-18(13)7-11-2-3-12(5-16)14(15)4-11;/h2-4,6,9H,7-8H2,1H3;1H |
| InChIKey | FWJPUNMXMCATKT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide?
The IUPAC name of [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide (CID 18535996) is [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide.
What is the SMILES notation for [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide?
The canonical SMILES for [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide is Br.CC(=O)OCc1cncn1Cc1ccc(C#N)c(F)c1.
What is the InChIKey of [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide?
The InChIKey is FWJPUNMXMCATKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3O2.BrH/c1-10(19)20-8-13-6-17-9-18(13)7-11-2-3-12(5-16)14(15)4-11;/h2-4,6,9H,7-8H2,1H3;1H.
What are the key properties of [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide?
[3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide has a molecular weight of 354.18 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-cyano-3-fluorophenyl)methyl]imidazol-4-yl]methyl acetate;hydrobromide is sourced from PubChem (CID 18535996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).