C20H18F3N3O4S3 — CID 18536901
5-methylsulfanyl-4-[(4-phenylphenyl)sulfonylamino]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 18536901) has the molecular formula C20H18F3N3O4S3 and a molecular weight of 517.58 g/mol. Its IUPAC name is 5-methylsulfanyl-4-[(4-phenylphenyl)sulfonylamino]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-methylsulfanyl-4-[(4-phenylphenyl)sulfonylamino]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18536901 |
| Molecular Formula | C20H18F3N3O4S3 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | 5-methylsulfanyl-4-[(4-phenylphenyl)sulfonylamino]thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)c(SC)s1 |
| InChI | InChI=1S/C18H17N3O2S3.C2HF3O2/c1-24-18-15(11-16(25-18)17(19)20)21-26(22,23)14-9-7-13(8-10-14)12-5-3-2-4-6-12;3-2(4,5)1(6)7/h2-11,21H,1H3,(H3,19,20);(H,6,7) |
| InChIKey | MKVBZZJRDLTTPF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|