C17H15F3N4O2S2 — CID 18537040
5-methylsulfanyl-4-(5-phenyl-1H-imidazol-2-yl)thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 18537040) has the molecular formula C17H15F3N4O2S2 and a molecular weight of 428.46 g/mol. Its IUPAC name is 5-methylsulfanyl-4-(5-phenyl-1H-imidazol-2-yl)thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-methylsulfanyl-4-(5-phenyl-1H-imidazol-2-yl)thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18537040 |
| Molecular Formula | C17H15F3N4O2S2 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 5-methylsulfanyl-4-(5-phenyl-1H-imidazol-2-yl)thiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(-c2ncc(-c3ccccc3)[nH]2)c(SC)s1 |
| InChI | InChI=1S/C15H14N4S2.C2HF3O2/c1-20-15-10(7-12(21-15)13(16)17)14-18-8-11(19-14)9-5-3-2-4-6-9;3-2(4,5)1(6)7/h2-8H,1H3,(H3,16,17)(H,18,19);(H,6,7) |
| InChIKey | ISOJVCYJLHGBMO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|