About 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide
4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide (PubChem CID 18537123) has the molecular formula C14H16N4S2
and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide.
Molecular Properties
| Compound Name | 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide |
| PubChem CID | 18537123 |
| Molecular Formula | C14H16N4S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(/C(N)=N/Cc2ccccc2)c(SC)s1 |
| InChI | InChI=1S/C14H16N4S2/c1-19-14-10(7-11(20-14)12(15)16)13(17)18-8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H3,15,16)(H2,17,18) |
| InChIKey | WRJPIMZEUNNODH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide?
The IUPAC name of 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide (CID 18537123) is 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide.
What is the SMILES notation for 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide?
The canonical SMILES for 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide is [H]/N=C(\N)c1cc(/C(N)=N/Cc2ccccc2)c(SC)s1.
What is the InChIKey of 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide?
The InChIKey is WRJPIMZEUNNODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4S2/c1-19-14-10(7-11(20-14)12(15)16)13(17)18-8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H3,15,16)(H2,17,18).
What are the key properties of 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide?
4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide has a molecular weight of 304.44 g/mol, XLogP of 2.66, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N'-benzyl-5-methylsulfanylthiophene-2,4-dicarboximidamide is sourced from PubChem (CID 18537123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).