About 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide
4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide (PubChem CID 18537308) has the molecular formula C15H14N4S3
and a molecular weight of 346.51 g/mol. Its IUPAC name is 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide.
Molecular Properties
| Compound Name | 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide |
| PubChem CID | 18537308 |
| Molecular Formula | C15H14N4S3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2csc(Nc3ccccc3)n2)c(SC)s1 |
| InChI | InChI=1S/C15H14N4S3/c1-20-14-10(7-12(22-14)13(16)17)11-8-21-15(19-11)18-9-5-3-2-4-6-9/h2-8H,1H3,(H3,16,17)(H,18,19) |
| InChIKey | BOBLTMKWXURBGT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide?
The IUPAC name of 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide (CID 18537308) is 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide.
What is the SMILES notation for 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide?
The canonical SMILES for 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide is [H]/N=C(\N)c1cc(-c2csc(Nc3ccccc3)n2)c(SC)s1.
What is the InChIKey of 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide?
The InChIKey is BOBLTMKWXURBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4S3/c1-20-14-10(7-12(22-14)13(16)17)11-8-21-15(19-11)18-9-5-3-2-4-6-9/h2-8H,1H3,(H3,16,17)(H,18,19).
What are the key properties of 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide?
4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide has a molecular weight of 346.51 g/mol, XLogP of 4.62, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-anilino-1,3-thiazol-4-yl)-5-methylsulfanylthiophene-2-carboximidamide is sourced from PubChem (CID 18537308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).