About 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid
6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid (PubChem CID 18537526) has the molecular formula C23H25F2N3O2
and a molecular weight of 413.47 g/mol. Its IUPAC name is 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid.
Molecular Properties
| Compound Name | 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid |
| PubChem CID | 18537526 |
| Molecular Formula | C23H25F2N3O2 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid |
| SMILES | Cc1nc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CCCCCCNC(=O)O |
| InChI | InChI=1S/C23H25F2N3O2/c1-16-27-21(17-6-10-19(24)11-7-17)22(18-8-12-20(25)13-9-18)28(16)15-5-3-2-4-14-26-23(29)30/h6-13,26H,2-5,14-15H2,1H3,(H,29,30) |
| InChIKey | INVRLIQNYCOEFF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid?
The IUPAC name of 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid (CID 18537526) is 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid.
What is the SMILES notation for 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid?
The canonical SMILES for 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid is Cc1nc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CCCCCCNC(=O)O.
What is the InChIKey of 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid?
The InChIKey is INVRLIQNYCOEFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25F2N3O2/c1-16-27-21(17-6-10-19(24)11-7-17)22(18-8-12-20(25)13-9-18)28(16)15-5-3-2-4-14-26-23(29)30/h6-13,26H,2-5,14-15H2,1H3,(H,29,30).
What are the key properties of 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid?
6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid has a molecular weight of 413.47 g/mol, XLogP of 5.63, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4,5-bis(4-fluorophenyl)-2-methylimidazol-1-yl]hexylcarbamic acid is sourced from PubChem (CID 18537526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).