C29H24N4O4S — CID 18537577
5-[[4-[1-[6-(8-aminonaphthalen-2-yl)oxy-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 18537577) has the molecular formula C29H24N4O4S and a molecular weight of 524.60 g/mol. Its IUPAC name is 5-[[4-[1-[6-(8-aminonaphthalen-2-yl)oxy-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[1-[6-(8-aminonaphthalen-2-yl)oxy-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18537577 |
| Molecular Formula | C29H24N4O4S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 5-[[4-[1-[6-(8-aminonaphthalen-2-yl)oxy-1H-benzimidazol-2-yl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(Oc1ccc(CC2SC(=O)NC2=O)cc1)c1nc2ccc(Oc3ccc4cccc(N)c4c3)cc2[nH]1 |
| InChI | InChI=1S/C29H24N4O4S/c1-16(36-19-8-5-17(6-9-19)13-26-28(34)33-29(35)38-26)27-31-24-12-11-21(15-25(24)32-27)37-20-10-7-18-3-2-4-23(30)22(18)14-20/h2-12,14-16,26H,13,30H2,1H3,(H,31,32)(H,33,34,35) |
| InChIKey | ATMBWCCGYBYZFY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|