C12H16F7N — CID 18538152
2,2,3,3,4,4,5-heptafluoro-5-methyl-1-(4-methylcyclohexyl)pyrrolidine (PubChem CID 18538152) has the molecular formula C12H16F7N and a molecular weight of 307.25 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptafluoro-5-methyl-1-(4-methylcyclohexyl)pyrrolidine.
| Compound Name | 2,2,3,3,4,4,5-heptafluoro-5-methyl-1-(4-methylcyclohexyl)pyrrolidine |
|---|---|
| PubChem CID | 18538152 |
| Molecular Formula | C12H16F7N |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2,2,3,3,4,4,5-heptafluoro-5-methyl-1-(4-methylcyclohexyl)pyrrolidine |
| SMILES | CC1CCC(N2C(C)(F)C(F)(F)C(F)(F)C2(F)F)CC1 |
| InChI | InChI=1S/C12H16F7N/c1-7-3-5-8(6-4-7)20-9(2,13)10(14,15)11(16,17)12(20,18)19/h7-8H,3-6H2,1-2H3 |
| InChIKey | VJMIKELKMSBZIJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|