C9H9F9 — CID 18538156
1,1,2,2,3,3,4,4,4-nonafluorobutylcyclopentane (PubChem CID 18538156) has the molecular formula C9H9F9 and a molecular weight of 288.15 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutylcyclopentane.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylcyclopentane |
|---|---|
| PubChem CID | 18538156 |
| Molecular Formula | C9H9F9 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylcyclopentane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CCCC1 |
| InChI | InChI=1S/C9H9F9/c10-6(11,5-3-1-2-4-5)7(12,13)8(14,15)9(16,17)18/h5H,1-4H2 |
| InChIKey | KCQVULZWHSHSFY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|