About 3-oxohexanedial
3-oxohexanedial (PubChem CID 18538325) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is 3-oxohexanedial.
Molecular Properties
| Compound Name | 3-oxohexanedial |
| PubChem CID | 18538325 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 3-oxohexanedial |
| SMILES | O=CCCC(=O)CC=O |
| InChI | InChI=1S/C6H8O3/c7-4-1-2-6(9)3-5-8/h4-5H,1-3H2 |
| InChIKey | PAXFMQWEAJBIJB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxohexanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxohexanedial?
The IUPAC name of 3-oxohexanedial (CID 18538325) is 3-oxohexanedial.
What is the SMILES notation for 3-oxohexanedial?
The canonical SMILES for 3-oxohexanedial is O=CCCC(=O)CC=O.
What is the InChIKey of 3-oxohexanedial?
The InChIKey is PAXFMQWEAJBIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c7-4-1-2-6(9)3-5-8/h4-5H,1-3H2.
What are the key properties of 3-oxohexanedial?
3-oxohexanedial has a molecular weight of 128.13 g/mol, XLogP of 0.12, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxohexanedial is sourced from PubChem (CID 18538325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).