C29H39ClN4O2 — CID 18538481
1-acetyl-N-[3-[(1-benzylpiperidin-4-yl)amino]propyl]-N-(3-chlorophenyl)piperidine-4-carboxamide (PubChem CID 18538481) has the molecular formula C29H39ClN4O2 and a molecular weight of 511.11 g/mol. Its IUPAC name is 1-acetyl-N-[3-[(1-benzylpiperidin-4-yl)amino]propyl]-N-(3-chlorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[3-[(1-benzylpiperidin-4-yl)amino]propyl]-N-(3-chlorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 18538481 |
| Molecular Formula | C29H39ClN4O2 |
| Molecular Weight | 511.11 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 1-acetyl-N-[3-[(1-benzylpiperidin-4-yl)amino]propyl]-N-(3-chlorophenyl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)N(CCCNC2CCN(Cc3ccccc3)CC2)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C29H39ClN4O2/c1-23(35)33-19-11-25(12-20-33)29(36)34(28-10-5-9-26(30)21-28)16-6-15-31-27-13-17-32(18-14-27)22-24-7-3-2-4-8-24/h2-5,7-10,21,25,27,31H,6,11-20,22H2,1H3 |
| InChIKey | SLDAHGGGQYGAPK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.11 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|