C33H37Cl2FN4O5S — CID 18539023
N-(3,4-dichlorophenyl)-N-[3-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]-1-(3-nitrophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 18539023) has the molecular formula C33H37Cl2FN4O5S and a molecular weight of 691.65 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N-[3-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]-1-(3-nitrophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-N-[3-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]-1-(3-nitrophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 18539023 |
| Molecular Formula | C33H37Cl2FN4O5S |
| Molecular Weight | 691.65 g/mol |
| Exact Mass | 690.18 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N-[3-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]-1-(3-nitrophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1)N(CCCN1CCC(Cc2ccc(F)cc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C33H37Cl2FN4O5S/c34-31-10-9-28(23-32(31)35)39(16-2-15-37-17-11-25(12-18-37)21-24-5-7-27(36)8-6-24)33(41)26-13-19-38(20-14-26)46(44,45)30-4-1-3-29(22-30)40(42)43/h1,3-10,22-23,25-26H,2,11-21H2 |
| InChIKey | HPCOGLXDULTPTL-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|