C6H10F4N6O4 — CID 18539312
3-N,3-N,3-N',3-N'-tetrafluoro-7,7-dinitro-1,5-diazocane-3,3-diamine (PubChem CID 18539312) has the molecular formula C6H10F4N6O4 and a molecular weight of 306.18 g/mol. Its IUPAC name is 3-N,3-N,3-N',3-N'-tetrafluoro-7,7-dinitro-1,5-diazocane-3,3-diamine.
| Compound Name | 3-N,3-N,3-N',3-N'-tetrafluoro-7,7-dinitro-1,5-diazocane-3,3-diamine |
|---|---|
| PubChem CID | 18539312 |
| Molecular Formula | C6H10F4N6O4 |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-N,3-N,3-N',3-N'-tetrafluoro-7,7-dinitro-1,5-diazocane-3,3-diamine |
| SMILES | O=[N+]([O-])C1([N+](=O)[O-])CNCC(N(F)F)(N(F)F)CNC1 |
| InChI | InChI=1S/C6H10F4N6O4/c7-13(8)5(14(9)10)1-11-3-6(15(17)18,16(19)20)4-12-2-5/h11-12H,1-4H2 |
| InChIKey | SOXVNOYOPQBCFY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|