C26H31FN4O4 — CID 18540190
tert-butyl 4-[3-[3-fluoro-4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenoxy]propyl]piperazine-1-carboxylate (PubChem CID 18540190) has the molecular formula C26H31FN4O4 and a molecular weight of 482.56 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-fluoro-4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenoxy]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-fluoro-4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenoxy]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 18540190 |
| Molecular Formula | C26H31FN4O4 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | tert-butyl 4-[3-[3-fluoro-4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenoxy]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCOc2ccc(-c3noc(-c4ccccc4)n3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H31FN4O4/c1-26(2,3)34-25(32)31-15-13-30(14-16-31)12-7-17-33-20-10-11-21(22(27)18-20)23-28-24(35-29-23)19-8-5-4-6-9-19/h4-6,8-11,18H,7,12-17H2,1-3H3 |
| InChIKey | FCZPVKAHLUSQCG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|