C22H28N4O2 — CID 18540413
4-[3-[7-(2-pyrrol-1-ylethyl)-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]propoxy]benzonitrile (PubChem CID 18540413) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-[3-[7-(2-pyrrol-1-ylethyl)-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]propoxy]benzonitrile.
| Compound Name | 4-[3-[7-(2-pyrrol-1-ylethyl)-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 18540413 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 4-[3-[7-(2-pyrrol-1-ylethyl)-9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl]propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCCN2CC3CN(CCn4cccc4)CC(C2)O3)cc1 |
| InChI | InChI=1S/C22H28N4O2/c23-14-19-4-6-20(7-5-19)27-13-3-10-25-15-21-17-26(18-22(16-25)28-21)12-11-24-8-1-2-9-24/h1-2,4-9,21-22H,3,10-13,15-18H2 |
| InChIKey | NKBKQXVTZGHPAU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|