About 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide
6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide (PubChem CID 18540584) has the molecular formula C8H10Br2N6
and a molecular weight of 350.02 g/mol. Its IUPAC name is 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide.
Molecular Properties
| Compound Name | 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide |
| PubChem CID | 18540584 |
| Molecular Formula | C8H10Br2N6 |
| Molecular Weight | 350.02 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide |
| SMILES | Br.CC(Br)c1cnc2nc(N)nc(N)c2n1 |
| InChI | InChI=1S/C8H9BrN6.BrH/c1-3(9)4-2-12-7-5(13-4)6(10)14-8(11)15-7;/h2-3H,1H3,(H4,10,11,12,14,15);1H |
| InChIKey | VIZHYOHARODBDT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.02 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide?
The IUPAC name of 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide (CID 18540584) is 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide.
What is the SMILES notation for 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide?
The canonical SMILES for 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide is Br.CC(Br)c1cnc2nc(N)nc(N)c2n1.
What is the InChIKey of 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide?
The InChIKey is VIZHYOHARODBDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN6.BrH/c1-3(9)4-2-12-7-5(13-4)6(10)14-8(11)15-7;/h2-3H,1H3,(H4,10,11,12,14,15);1H.
What are the key properties of 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide?
6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide has a molecular weight of 350.02 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-bromoethyl)pteridine-2,4-diamine;hydrobromide is sourced from PubChem (CID 18540584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).