C23H34NO2+ — CID 18541
trimethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propoxy]ethyl]azanium (PubChem CID 18541) has the molecular formula C23H34NO2+ and a molecular weight of 356.53 g/mol. Its IUPAC name is trimethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propoxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propoxy]ethyl]azanium |
|---|---|
| PubChem CID | 18541 |
| Molecular Formula | C23H34NO2+ |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | trimethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propoxy]ethyl]azanium |
| SMILES | C[N+](C)(C)CCOCC(Cc1cccc2ccccc12)CC1CCCO1 |
| InChI | InChI=1S/C23H34NO2/c1-24(2,3)13-15-25-18-19(17-22-11-7-14-26-22)16-21-10-6-9-20-8-4-5-12-23(20)21/h4-6,8-10,12,19,22H,7,11,13-18H2,1-3H3/q+1 |
| InChIKey | YHCVZNGZHXNNOK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|