C16H39N5 — CID 18541605
3-[[2-(dimethylamino)ethylamino]methyl]-1-N,1-N,3-N,3-N,5-N,5-N-hexamethylpentane-1,3,5-triamine (PubChem CID 18541605) has the molecular formula C16H39N5 and a molecular weight of 301.52 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)ethylamino]methyl]-1-N,1-N,3-N,3-N,5-N,5-N-hexamethylpentane-1,3,5-triamine.
| Compound Name | 3-[[2-(dimethylamino)ethylamino]methyl]-1-N,1-N,3-N,3-N,5-N,5-N-hexamethylpentane-1,3,5-triamine |
|---|---|
| PubChem CID | 18541605 |
| Molecular Formula | C16H39N5 |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.32 |
| IUPAC Name | 3-[[2-(dimethylamino)ethylamino]methyl]-1-N,1-N,3-N,3-N,5-N,5-N-hexamethylpentane-1,3,5-triamine |
| SMILES | CN(C)CCNCC(CCN(C)C)(CCN(C)C)N(C)C |
| InChI | InChI=1S/C16H39N5/c1-18(2)12-9-16(21(7)8,10-13-19(3)4)15-17-11-14-20(5)6/h17H,9-15H2,1-8H3 |
| InChIKey | VADKVAONKAYUEF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 24.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|