C15H10N2O4 — CID 18541956
3-[4-(2,5-dioxopyrrol-3-yl)-5-methylidenecyclohexa-1,3-dien-1-yl]pyrrole-2,5-dione (PubChem CID 18541956) has the molecular formula C15H10N2O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 3-[4-(2,5-dioxopyrrol-3-yl)-5-methylidenecyclohexa-1,3-dien-1-yl]pyrrole-2,5-dione.
| Compound Name | 3-[4-(2,5-dioxopyrrol-3-yl)-5-methylidenecyclohexa-1,3-dien-1-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 18541956 |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-[4-(2,5-dioxopyrrol-3-yl)-5-methylidenecyclohexa-1,3-dien-1-yl]pyrrole-2,5-dione |
| SMILES | C=C1CC(C2=CC(=O)NC2=O)=CC=C1C1=CC(=O)NC1=O |
| InChI | InChI=1S/C15H10N2O4/c1-7-4-8(10-5-12(18)16-14(10)20)2-3-9(7)11-6-13(19)17-15(11)21/h2-3,5-6H,1,4H2,(H,16,18,20)(H,17,19,21) |
| InChIKey | NKXNMQJOGMOGJZ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|