C26H35NO7 — CID 18542
diethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoyl]oxyethyl]azanium;2-hydroxy-2-oxoacetate (PubChem CID 18542) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is diethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoyl]oxyethyl]azanium;2-hydroxy-2-oxoacetate.
| Compound Name | diethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoyl]oxyethyl]azanium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 18542 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | diethyl-[2-[2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoyl]oxyethyl]azanium;2-hydroxy-2-oxoacetate |
| SMILES | CC[NH+](CC)CCOC(=O)C(Cc1cccc2ccccc12)CC1CCCO1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C24H33NO3.C2H2O4/c1-3-25(4-2)14-16-28-24(26)21(18-22-12-8-15-27-22)17-20-11-7-10-19-9-5-6-13-23(19)20;3-1(4)2(5)6/h5-7,9-11,13,21-22H,3-4,8,12,14-18H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | SSAJNPNVUYMUCI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|