C38H53F5O4S — CID 18544011
methyl 11-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoate (PubChem CID 18544011) has the molecular formula C38H53F5O4S and a molecular weight of 700.89 g/mol. Its IUPAC name is methyl 11-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoate.
| Compound Name | methyl 11-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoate |
|---|---|
| PubChem CID | 18544011 |
| Molecular Formula | C38H53F5O4S |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | methyl 11-[7-methoxy-3-(4-methoxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(7,7,8,8,8-pentafluorooctyl)undecanoate |
| SMILES | COC(=O)C(CCCCCCCCCC1c2ccc(OC)cc2SCC1(C)c1ccc(OC)cc1)CCCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C38H53F5O4S/c1-36(29-19-21-30(45-2)22-20-29)27-48-34-26-31(46-3)23-24-32(34)33(36)18-14-9-7-5-6-8-12-16-28(35(44)47-4)17-13-10-11-15-25-37(39,40)38(41,42)43/h19-24,26,28,33H,5-18,25,27H2,1-4H3 |
| InChIKey | XNXYLNKOOWWBGW-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|